C17H26N4O — CID 134568892
4-N-butyl-5-[(5,6-dimethylcyclohexa-1,3-dien-1-yl)methoxy]pyrimidine-2,4-diamine (PubChem CID 134568892) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-N-butyl-5-[(5,6-dimethylcyclohexa-1,3-dien-1-yl)methoxy]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[(5,6-dimethylcyclohexa-1,3-dien-1-yl)methoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134568892 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 4-N-butyl-5-[(5,6-dimethylcyclohexa-1,3-dien-1-yl)methoxy]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCC1=CC=CC(C)C1C |
| InChI | InChI=1S/C17H26N4O/c1-4-5-9-19-16-15(10-20-17(18)21-16)22-11-14-8-6-7-12(2)13(14)3/h6-8,10,12-13H,4-5,9,11H2,1-3H3,(H3,18,19,20,21) |
| InChIKey | PGSODZHJPSBSRG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|