C16H22F2N4O2 — CID 123251818
4-N-butyl-5-[[5-(1,1-difluoropropyl)furan-2-yl]methoxy]pyrimidine-2,4-diamine (PubChem CID 123251818) has the molecular formula C16H22F2N4O2 and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-N-butyl-5-[[5-(1,1-difluoropropyl)furan-2-yl]methoxy]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[[5-(1,1-difluoropropyl)furan-2-yl]methoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123251818 |
| Molecular Formula | C16H22F2N4O2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-N-butyl-5-[[5-(1,1-difluoropropyl)furan-2-yl]methoxy]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCc1ccc(C(F)(F)CC)o1 |
| InChI | InChI=1S/C16H22F2N4O2/c1-3-5-8-20-14-12(9-21-15(19)22-14)23-10-11-6-7-13(24-11)16(17,18)4-2/h6-7,9H,3-5,8,10H2,1-2H3,(H3,19,20,21,22) |
| InChIKey | YUGCLGAJQYPBPD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|