C13H24N4 — CID 18737835
4-N,5-N-dibutyl-2-methylpyrimidine-4,5-diamine (PubChem CID 18737835) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-N,5-N-dibutyl-2-methylpyrimidine-4,5-diamine.
| Compound Name | 4-N,5-N-dibutyl-2-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 18737835 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-N,5-N-dibutyl-2-methylpyrimidine-4,5-diamine |
| SMILES | CCCCNc1cnc(C)nc1NCCCC |
| InChI | InChI=1S/C13H24N4/c1-4-6-8-14-12-10-16-11(3)17-13(12)15-9-7-5-2/h10,14H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | PDLADJPPSCHZHC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|