C11H17N5 — CID 171384557
N-butyl-2,9-dimethylpurin-8-amine (PubChem CID 171384557) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is N-butyl-2,9-dimethylpurin-8-amine.
| Compound Name | N-butyl-2,9-dimethylpurin-8-amine |
|---|---|
| PubChem CID | 171384557 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-butyl-2,9-dimethylpurin-8-amine |
| SMILES | CCCCNc1nc2cnc(C)nc2n1C |
| InChI | InChI=1S/C11H17N5/c1-4-5-6-12-11-15-9-7-13-8(2)14-10(9)16(11)3/h7H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | NLJYRBBAGNJCRN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|