C12H16ClN3 — CID 106845045
N-(4-chlorobutyl)-1-methylbenzimidazol-2-amine (PubChem CID 106845045) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is N-(4-chlorobutyl)-1-methylbenzimidazol-2-amine.
| Compound Name | N-(4-chlorobutyl)-1-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 106845045 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(4-chlorobutyl)-1-methylbenzimidazol-2-amine |
| SMILES | Cn1c(NCCCCCl)nc2ccccc21 |
| InChI | InChI=1S/C12H16ClN3/c1-16-11-7-3-2-6-10(11)15-12(16)14-9-5-4-8-13/h2-3,6-7H,4-5,8-9H2,1H3,(H,14,15) |
| InChIKey | PONBUBDFKXJATJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|