C10H13N3S — CID 21226750
2-[(1-methylbenzimidazol-2-yl)amino]ethanethiol (PubChem CID 21226750) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-[(1-methylbenzimidazol-2-yl)amino]ethanethiol.
| Compound Name | 2-[(1-methylbenzimidazol-2-yl)amino]ethanethiol |
|---|---|
| PubChem CID | 21226750 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-[(1-methylbenzimidazol-2-yl)amino]ethanethiol |
| SMILES | Cn1c(NCCS)nc2ccccc21 |
| InChI | InChI=1S/C10H13N3S/c1-13-9-5-3-2-4-8(9)12-10(13)11-6-7-14/h2-5,14H,6-7H2,1H3,(H,11,12) |
| InChIKey | MQSZWVKGBNTNNM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|