C14H21N3O — CID 106185170
2,3-dimethyl-3-[(1-methylbenzimidazol-2-yl)amino]butan-2-ol (PubChem CID 106185170) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,3-dimethyl-3-[(1-methylbenzimidazol-2-yl)amino]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[(1-methylbenzimidazol-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 106185170 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2,3-dimethyl-3-[(1-methylbenzimidazol-2-yl)amino]butan-2-ol |
| SMILES | Cn1c(NC(C)(C)C(C)(C)O)nc2ccccc21 |
| InChI | InChI=1S/C14H21N3O/c1-13(2,14(3,4)18)16-12-15-10-8-6-7-9-11(10)17(12)5/h6-9,18H,1-5H3,(H,15,16) |
| InChIKey | DHULLQGHUYQGJS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |