C15H23N3O2 — CID 115735418
N-[4-(2-methoxyethoxy)butyl]-1-methylbenzimidazol-2-amine (PubChem CID 115735418) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)butyl]-1-methylbenzimidazol-2-amine.
| Compound Name | N-[4-(2-methoxyethoxy)butyl]-1-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 115735418 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[4-(2-methoxyethoxy)butyl]-1-methylbenzimidazol-2-amine |
| SMILES | COCCOCCCCNc1nc2ccccc2n1C |
| InChI | InChI=1S/C15H23N3O2/c1-18-14-8-4-3-7-13(14)17-15(18)16-9-5-6-10-20-12-11-19-2/h3-4,7-8H,5-6,9-12H2,1-2H3,(H,16,17) |
| InChIKey | CVBSGUWMPHMCHK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|