C18H18Cl2N3O- — CID 53312832
2-[2-(3-chloropropylamino)benzimidazol-1-yl]-1-phenylethanone chloride (PubChem CID 53312832) has the molecular formula C18H18Cl2N3O- and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-[2-(3-chloropropylamino)benzimidazol-1-yl]-1-phenylethanone chloride.
| Compound Name | 2-[2-(3-chloropropylamino)benzimidazol-1-yl]-1-phenylethanone chloride |
|---|---|
| PubChem CID | 53312832 |
| Molecular Formula | C18H18Cl2N3O- |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-[2-(3-chloropropylamino)benzimidazol-1-yl]-1-phenylethanone chloride |
| SMILES | O=C(Cn1c(NCCCCl)nc2ccccc21)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H18ClN3O.ClH/c19-11-6-12-20-18-21-15-9-4-5-10-16(15)22(18)13-17(23)14-7-2-1-3-8-14;/h1-5,7-10H,6,11-13H2,(H,20,21);1H/p-1 |
| InChIKey | GLWYNVGYUKBFMY-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|