C15H19F2N3 — CID 106583625
N-butyl-1-(2,5-difluoro-4-methylphenyl)-4-methylimidazol-2-amine (PubChem CID 106583625) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is N-butyl-1-(2,5-difluoro-4-methylphenyl)-4-methylimidazol-2-amine.
| Compound Name | N-butyl-1-(2,5-difluoro-4-methylphenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106583625 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-butyl-1-(2,5-difluoro-4-methylphenyl)-4-methylimidazol-2-amine |
| SMILES | CCCCNc1nc(C)cn1-c1cc(F)c(C)cc1F |
| InChI | InChI=1S/C15H19F2N3/c1-4-5-6-18-15-19-11(3)9-20(15)14-8-12(16)10(2)7-13(14)17/h7-9H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | BUGUMZGXESIAMP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|