C13H14BrF2N3O — CID 106583039
1-(5-bromo-2,4-difluorophenyl)-N-(2-methoxyethyl)-4-methylimidazol-2-amine (PubChem CID 106583039) has the molecular formula C13H14BrF2N3O and a molecular weight of 346.18 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-N-(2-methoxyethyl)-4-methylimidazol-2-amine.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-N-(2-methoxyethyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106583039 |
| Molecular Formula | C13H14BrF2N3O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-N-(2-methoxyethyl)-4-methylimidazol-2-amine |
| SMILES | COCCNc1nc(C)cn1-c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C13H14BrF2N3O/c1-8-7-19(13(18-8)17-3-4-20-2)12-5-9(14)10(15)6-11(12)16/h5-7H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | VOMYMTQRXLXBJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|