C15H16BrF2N3 — CID 106583046
1-(5-bromo-2,4-difluorophenyl)-N-cyclopentyl-4-methylimidazol-2-amine (PubChem CID 106583046) has the molecular formula C15H16BrF2N3 and a molecular weight of 356.21 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-N-cyclopentyl-4-methylimidazol-2-amine.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-N-cyclopentyl-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106583046 |
| Molecular Formula | C15H16BrF2N3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-N-cyclopentyl-4-methylimidazol-2-amine |
| SMILES | Cc1cn(-c2cc(Br)c(F)cc2F)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C15H16BrF2N3/c1-9-8-21(14-6-11(16)12(17)7-13(14)18)15(19-9)20-10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,19,20) |
| InChIKey | RBVPERVFNXQJEH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|