C13H12F3N3 — CID 106570979
N-cyclopropyl-4-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine (PubChem CID 106570979) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-4-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570979 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-cyclopropyl-4-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine |
| SMILES | Cc1cn(-c2cc(F)cc(F)c2F)c(NC2CC2)n1 |
| InChI | InChI=1S/C13H12F3N3/c1-7-6-19(13(17-7)18-9-2-3-9)11-5-8(14)4-10(15)12(11)16/h4-6,9H,2-3H2,1H3,(H,17,18) |
| InChIKey | AMPDWMJRGDVGLL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|