C14H17BrClN3O — CID 106577977
1-(2-bromo-5-chlorophenyl)-N-(3-methoxypropyl)-4-methylimidazol-2-amine (PubChem CID 106577977) has the molecular formula C14H17BrClN3O and a molecular weight of 358.67 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-N-(3-methoxypropyl)-4-methylimidazol-2-amine.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-N-(3-methoxypropyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106577977 |
| Molecular Formula | C14H17BrClN3O |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-N-(3-methoxypropyl)-4-methylimidazol-2-amine |
| SMILES | COCCCNc1nc(C)cn1-c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C14H17BrClN3O/c1-10-9-19(13-8-11(16)4-5-12(13)15)14(18-10)17-6-3-7-20-2/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,18) |
| InChIKey | WMVIWHLUOFMGRE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|