C15H19Br2N3O — CID 106568715
1-(2,4-dibromophenyl)-N-(3-ethoxypropyl)-4-methylimidazol-2-amine (PubChem CID 106568715) has the molecular formula C15H19Br2N3O and a molecular weight of 417.15 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-(3-ethoxypropyl)-4-methylimidazol-2-amine.
| Compound Name | 1-(2,4-dibromophenyl)-N-(3-ethoxypropyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106568715 |
| Molecular Formula | C15H19Br2N3O |
| Molecular Weight | 417.15 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-(3-ethoxypropyl)-4-methylimidazol-2-amine |
| SMILES | CCOCCCNc1nc(C)cn1-c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H19Br2N3O/c1-3-21-8-4-7-18-15-19-11(2)10-20(15)14-6-5-12(16)9-13(14)17/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | DCBQKEQQFJHSJC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|