About 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine
1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine (PubChem CID 106583526) has the molecular formula C14H17Br2N3O
and a molecular weight of 403.12 g/mol. Its IUPAC name is 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine.
Molecular Properties
| Compound Name | 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine |
| PubChem CID | 106583526 |
| Molecular Formula | C14H17Br2N3O |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine |
| SMILES | CCCNc1nc(C)cn1-c1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C14H17Br2N3O/c1-4-5-17-14-18-9(2)8-19(14)12-7-13(20-3)11(16)6-10(12)15/h6-8H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | FYTBUQJVXIPYTA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine?
The IUPAC name of 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine (CID 106583526) is 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine.
What is the SMILES notation for 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine?
The canonical SMILES for 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine is CCCNc1nc(C)cn1-c1cc(OC)c(Br)cc1Br.
What is the InChIKey of 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine?
The InChIKey is FYTBUQJVXIPYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Br2N3O/c1-4-5-17-14-18-9(2)8-19(14)12-7-13(20-3)11(16)6-10(12)15/h6-8H,4-5H2,1-3H3,(H,17,18).
What are the key properties of 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine?
1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine has a molecular weight of 403.12 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dibromo-5-methoxyphenyl)-4-methyl-N-propylimidazol-2-amine is sourced from PubChem (CID 106583526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).