C14H17F2N3 — CID 106556857
N-butyl-1-(2,5-difluorophenyl)-4-methylimidazol-2-amine (PubChem CID 106556857) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-butyl-1-(2,5-difluorophenyl)-4-methylimidazol-2-amine.
| Compound Name | N-butyl-1-(2,5-difluorophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106556857 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-butyl-1-(2,5-difluorophenyl)-4-methylimidazol-2-amine |
| SMILES | CCCCNc1nc(C)cn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C14H17F2N3/c1-3-4-7-17-14-18-10(2)9-19(14)13-8-11(15)5-6-12(13)16/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | TXZFOPVOFCZYRP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|