C8H13N3 — CID 171795790
N-ethyl-2,4-dimethylpyrimidin-5-amine (PubChem CID 171795790) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N-ethyl-2,4-dimethylpyrimidin-5-amine.
| Compound Name | N-ethyl-2,4-dimethylpyrimidin-5-amine |
|---|---|
| PubChem CID | 171795790 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-ethyl-2,4-dimethylpyrimidin-5-amine |
| SMILES | CCNc1cnc(C)nc1C |
| InChI | InChI=1S/C8H13N3/c1-4-9-8-5-10-7(3)11-6(8)2/h5,9H,4H2,1-3H3 |
| InChIKey | GWYUXDLIVQZKFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |