C8H14N4 — CID 126972399
5-(aminomethyl)-N-ethyl-2-methylpyrimidin-4-amine (PubChem CID 126972399) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 5-(aminomethyl)-N-ethyl-2-methylpyrimidin-4-amine.
| Compound Name | 5-(aminomethyl)-N-ethyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 126972399 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 5-(aminomethyl)-N-ethyl-2-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C)ncc1CN |
| InChI | InChI=1S/C8H14N4/c1-3-10-8-7(4-9)5-11-6(2)12-8/h5H,3-4,9H2,1-2H3,(H,10,11,12) |
| InChIKey | JZWDEIITWPYQLM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |