C13H24N4 — CID 114216522
N-tert-butyl-2-methyl-5-(propylaminomethyl)pyrimidin-4-amine (PubChem CID 114216522) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-5-(propylaminomethyl)pyrimidin-4-amine.
| Compound Name | N-tert-butyl-2-methyl-5-(propylaminomethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114216522 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-tert-butyl-2-methyl-5-(propylaminomethyl)pyrimidin-4-amine |
| SMILES | CCCNCc1cnc(C)nc1NC(C)(C)C |
| InChI | InChI=1S/C13H24N4/c1-6-7-14-8-11-9-15-10(2)16-12(11)17-13(3,4)5/h9,14H,6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | TYPBGQJYAKDBCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|