C15H28N4 — CID 83186192
4-methyl-N,N-dipropyl-5-(propylaminomethyl)pyrimidin-2-amine (PubChem CID 83186192) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is 4-methyl-N,N-dipropyl-5-(propylaminomethyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-N,N-dipropyl-5-(propylaminomethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 83186192 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 4-methyl-N,N-dipropyl-5-(propylaminomethyl)pyrimidin-2-amine |
| SMILES | CCCNCc1cnc(N(CCC)CCC)nc1C |
| InChI | InChI=1S/C15H28N4/c1-5-8-16-11-14-12-17-15(18-13(14)4)19(9-6-2)10-7-3/h12,16H,5-11H2,1-4H3 |
| InChIKey | MXUGEHLBJUTMAJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|