C14H26N4S — CID 112665398
N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)pyrimidin-2-amine (PubChem CID 112665398) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)pyrimidin-2-amine.
| Compound Name | N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112665398 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)pyrimidin-2-amine |
| SMILES | CCCNCc1cnc(N(C)C(C)CSC)nc1C |
| InChI | InChI=1S/C14H26N4S/c1-6-7-15-8-13-9-16-14(17-12(13)3)18(4)11(2)10-19-5/h9,11,15H,6-8,10H2,1-5H3 |
| InChIKey | KRMCCLSYQQXIQR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|