C15H28N4 — CID 83185424
N,4-dimethyl-N-(2-methylbutyl)-5-(propylaminomethyl)pyrimidin-2-amine (PubChem CID 83185424) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is N,4-dimethyl-N-(2-methylbutyl)-5-(propylaminomethyl)pyrimidin-2-amine.
| Compound Name | N,4-dimethyl-N-(2-methylbutyl)-5-(propylaminomethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 83185424 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | N,4-dimethyl-N-(2-methylbutyl)-5-(propylaminomethyl)pyrimidin-2-amine |
| SMILES | CCCNCc1cnc(N(C)CC(C)CC)nc1C |
| InChI | InChI=1S/C15H28N4/c1-6-8-16-9-14-10-17-15(18-13(14)4)19(5)11-12(3)7-2/h10,12,16H,6-9,11H2,1-5H3 |
| InChIKey | LURFJQNMKMRZOJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|