C11H19N3 — CID 60631563
3,6-dimethyl-N-pentylpyrazin-2-amine (PubChem CID 60631563) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3,6-dimethyl-N-pentylpyrazin-2-amine.
| Compound Name | 3,6-dimethyl-N-pentylpyrazin-2-amine |
|---|---|
| PubChem CID | 60631563 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3,6-dimethyl-N-pentylpyrazin-2-amine |
| SMILES | CCCCCNc1nc(C)cnc1C |
| InChI | InChI=1S/C11H19N3/c1-4-5-6-7-12-11-10(3)13-8-9(2)14-11/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | LDVZOCUPGIYFGM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|