C11H20N4 — CID 61019786
N'-(3,6-dimethylpyrazin-2-yl)-N-ethylpropane-1,3-diamine (PubChem CID 61019786) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-(3,6-dimethylpyrazin-2-yl)-N-ethylpropane-1,3-diamine.
| Compound Name | N'-(3,6-dimethylpyrazin-2-yl)-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61019786 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-(3,6-dimethylpyrazin-2-yl)-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNc1nc(C)cnc1C |
| InChI | InChI=1S/C11H20N4/c1-4-12-6-5-7-13-11-10(3)14-8-9(2)15-11/h8,12H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | PELCXPHZMUIFNK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|