C16H22N4 — CID 60631387
N-(3,6-dimethylpyrazin-2-yl)-N'-methyl-N'-phenylpropane-1,3-diamine (PubChem CID 60631387) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(3,6-dimethylpyrazin-2-yl)-N'-methyl-N'-phenylpropane-1,3-diamine.
| Compound Name | N-(3,6-dimethylpyrazin-2-yl)-N'-methyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60631387 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N-(3,6-dimethylpyrazin-2-yl)-N'-methyl-N'-phenylpropane-1,3-diamine |
| SMILES | Cc1cnc(C)c(NCCCN(C)c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4/c1-13-12-18-14(2)16(19-13)17-10-7-11-20(3)15-8-5-4-6-9-15/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,17,19) |
| InChIKey | PAOYCGFLNFOTLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|