C15H21N5 — CID 80784811
6-N-methyl-2-N-[3-(N-methylanilino)propyl]pyrazine-2,6-diamine (PubChem CID 80784811) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 6-N-methyl-2-N-[3-(N-methylanilino)propyl]pyrazine-2,6-diamine.
| Compound Name | 6-N-methyl-2-N-[3-(N-methylanilino)propyl]pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80784811 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 6-N-methyl-2-N-[3-(N-methylanilino)propyl]pyrazine-2,6-diamine |
| SMILES | CNc1cncc(NCCCN(C)c2ccccc2)n1 |
| InChI | InChI=1S/C15H21N5/c1-16-14-11-17-12-15(19-14)18-9-6-10-20(2)13-7-4-3-5-8-13/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H2,16,18,19) |
| InChIKey | LDDGVYHSMXVWLJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|