C16H23N5 — CID 80771230
6-N-ethyl-4-N-[3-(N-methylanilino)propyl]pyrimidine-4,6-diamine (PubChem CID 80771230) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 6-N-ethyl-4-N-[3-(N-methylanilino)propyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-ethyl-4-N-[3-(N-methylanilino)propyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80771230 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 6-N-ethyl-4-N-[3-(N-methylanilino)propyl]pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCCCN(C)c2ccccc2)ncn1 |
| InChI | InChI=1S/C16H23N5/c1-3-17-15-12-16(20-13-19-15)18-10-7-11-21(2)14-8-5-4-6-9-14/h4-6,8-9,12-13H,3,7,10-11H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | YSPFPWWTFJDBRC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|