C11H20N4O — CID 83029881
N'-(3,6-dimethylpyrazin-2-yl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 83029881) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N'-(3,6-dimethylpyrazin-2-yl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-(3,6-dimethylpyrazin-2-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 83029881 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N'-(3,6-dimethylpyrazin-2-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNCCNc1nc(C)cnc1C |
| InChI | InChI=1S/C11H20N4O/c1-9-8-14-10(2)11(15-9)13-5-4-12-6-7-16-3/h8,12H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | RFQWXMAOBOYMDZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|