C9H16N4 — CID 62659686
N'-(3,6-dimethylpyrazin-2-yl)-N-methylethane-1,2-diamine (PubChem CID 62659686) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-(3,6-dimethylpyrazin-2-yl)-N-methylethane-1,2-diamine.
| Compound Name | N'-(3,6-dimethylpyrazin-2-yl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62659686 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N'-(3,6-dimethylpyrazin-2-yl)-N-methylethane-1,2-diamine |
| SMILES | CNCCNc1nc(C)cnc1C |
| InChI | InChI=1S/C9H16N4/c1-7-6-12-8(2)9(13-7)11-5-4-10-3/h6,10H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | IGJHDGIDDKNTIT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|