C15H21N3 — CID 63229477
N-ethyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine (PubChem CID 63229477) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-ethyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 63229477 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-ethyl-N'-(3-methylquinolin-2-yl)propane-1,3-diamine |
| SMILES | CCNCCCNc1nc2ccccc2cc1C |
| InChI | InChI=1S/C15H21N3/c1-3-16-9-6-10-17-15-12(2)11-13-7-4-5-8-14(13)18-15/h4-5,7-8,11,16H,3,6,9-10H2,1-2H3,(H,17,18) |
| InChIKey | USLJKRLOPRTOMO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|