C14H25N3 — CID 65417975
3,6-dimethyl-N-octan-2-ylpyrazin-2-amine (PubChem CID 65417975) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 3,6-dimethyl-N-octan-2-ylpyrazin-2-amine.
| Compound Name | 3,6-dimethyl-N-octan-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 65417975 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 3,6-dimethyl-N-octan-2-ylpyrazin-2-amine |
| SMILES | CCCCCCC(C)Nc1nc(C)cnc1C |
| InChI | InChI=1S/C14H25N3/c1-5-6-7-8-9-11(2)16-14-13(4)15-10-12(3)17-14/h10-11H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | PPKZSILBHZBNMA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|