C13H24N4 — CID 80803176
4-N-heptan-2-yl-2-N,5-dimethylpyrimidine-2,4-diamine (PubChem CID 80803176) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-N-heptan-2-yl-2-N,5-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-heptan-2-yl-2-N,5-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80803176 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-N-heptan-2-yl-2-N,5-dimethylpyrimidine-2,4-diamine |
| SMILES | CCCCCC(C)Nc1nc(NC)ncc1C |
| InChI | InChI=1S/C13H24N4/c1-5-6-7-8-11(3)16-12-10(2)9-15-13(14-4)17-12/h9,11H,5-8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | BDAUBHSFUIPSOI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|