C9H15N3O — CID 65417320
2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol (PubChem CID 65417320) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol.
| Compound Name | 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 65417320 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol |
| SMILES | Cc1cnc(C)c(NC(C)CO)n1 |
| InChI | InChI=1S/C9H15N3O/c1-6-4-10-8(3)9(11-6)12-7(2)5-13/h4,7,13H,5H2,1-3H3,(H,11,12) |
| InChIKey | YYRROOIOOBGQCI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |