About 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol
2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol (PubChem CID 65417320) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol |
| PubChem CID | 65417320 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol |
| SMILES | Cc1cnc(C)c(NC(C)CO)n1 |
| InChI | InChI=1S/C9H15N3O/c1-6-4-10-8(3)9(11-6)12-7(2)5-13/h4,7,13H,5H2,1-3H3,(H,11,12) |
| InChIKey | YYRROOIOOBGQCI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol?
The IUPAC name of 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol (CID 65417320) is 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol.
What is the SMILES notation for 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol?
The canonical SMILES for 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol is Cc1cnc(C)c(NC(C)CO)n1.
What is the InChIKey of 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol?
The InChIKey is YYRROOIOOBGQCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-6-4-10-8(3)9(11-6)12-7(2)5-13/h4,7,13H,5H2,1-3H3,(H,11,12).
What are the key properties of 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol?
2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol has a molecular weight of 181.24 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,6-dimethylpyrazin-2-yl)amino]propan-1-ol is sourced from PubChem (CID 65417320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).