C16H25N3 — CID 63510639
4,6-dimethyl-2-(octan-2-ylamino)pyridine-3-carbonitrile (PubChem CID 63510639) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 4,6-dimethyl-2-(octan-2-ylamino)pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-(octan-2-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 63510639 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 4,6-dimethyl-2-(octan-2-ylamino)pyridine-3-carbonitrile |
| SMILES | CCCCCCC(C)Nc1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C16H25N3/c1-5-6-7-8-9-13(3)18-16-15(11-17)12(2)10-14(4)19-16/h10,13H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | RDEDYHKCGBMMDB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|