C13H15N3 — CID 106230781
4,6-dimethyl-2-(pent-1-yn-3-ylamino)pyridine-3-carbonitrile (PubChem CID 106230781) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4,6-dimethyl-2-(pent-1-yn-3-ylamino)pyridine-3-carbonitrile.
| Compound Name | 4,6-dimethyl-2-(pent-1-yn-3-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 106230781 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4,6-dimethyl-2-(pent-1-yn-3-ylamino)pyridine-3-carbonitrile |
| SMILES | C#CC(CC)Nc1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C13H15N3/c1-5-11(6-2)16-13-12(8-14)9(3)7-10(4)15-13/h1,7,11H,6H2,2-4H3,(H,15,16) |
| InChIKey | BEIYIFLLUVJUEE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|