C14H25N3 — CID 518401
N,N-dibutyl-3,6-dimethylpyrazin-2-amine (PubChem CID 518401) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N,N-dibutyl-3,6-dimethylpyrazin-2-amine.
| Compound Name | N,N-dibutyl-3,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 518401 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N,N-dibutyl-3,6-dimethylpyrazin-2-amine |
| SMILES | CCCCN(CCCC)c1nc(C)cnc1C |
| InChI | InChI=1S/C14H25N3/c1-5-7-9-17(10-8-6-2)14-13(4)15-11-12(3)16-14/h11H,5-10H2,1-4H3 |
| InChIKey | HFNGWNNJLWDPHQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |