C13H23FN4 — CID 80753683
4-N,4-N-dibutyl-5-fluoro-2-N-methylpyrimidine-2,4-diamine (PubChem CID 80753683) has the molecular formula C13H23FN4 and a molecular weight of 254.35 g/mol. Its IUPAC name is 4-N,4-N-dibutyl-5-fluoro-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N-dibutyl-5-fluoro-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80753683 |
| Molecular Formula | C13H23FN4 |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 4-N,4-N-dibutyl-5-fluoro-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CCCCN(CCCC)c1nc(NC)ncc1F |
| InChI | InChI=1S/C13H23FN4/c1-4-6-8-18(9-7-5-2)12-11(14)10-16-13(15-3)17-12/h10H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | AZLIVIRJLWJCQN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |