C8H14FN5O — CID 80898789
2-[ethyl-(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]ethanol (PubChem CID 80898789) has the molecular formula C8H14FN5O and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-[ethyl-(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[ethyl-(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 80898789 |
| Molecular Formula | C8H14FN5O |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-[ethyl-(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]ethanol |
| SMILES | CCN(CCO)c1nc(NN)ncc1F |
| InChI | InChI=1S/C8H14FN5O/c1-2-14(3-4-15)7-6(9)5-11-8(12-7)13-10/h5,15H,2-4,10H2,1H3,(H,11,12,13) |
| InChIKey | RJXOHWNKQILPSN-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|