C11H19FN4O — CID 80810772
2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propan-2-ylamino]ethanol (PubChem CID 80810772) has the molecular formula C11H19FN4O and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propan-2-ylamino]ethanol.
| Compound Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 80810772 |
| Molecular Formula | C11H19FN4O |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-propan-2-ylamino]ethanol |
| SMILES | CCNc1ncc(F)c(N(CCO)C(C)C)n1 |
| InChI | InChI=1S/C11H19FN4O/c1-4-13-11-14-7-9(12)10(15-11)16(5-6-17)8(2)3/h7-8,17H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | KOAIKSWAYGQMFB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |