C9H16ClN5O — CID 80904213
2-[(5-chloro-2-hydrazinylpyrimidin-4-yl)-propan-2-ylamino]ethanol (PubChem CID 80904213) has the molecular formula C9H16ClN5O and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-[(5-chloro-2-hydrazinylpyrimidin-4-yl)-propan-2-ylamino]ethanol.
| Compound Name | 2-[(5-chloro-2-hydrazinylpyrimidin-4-yl)-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 80904213 |
| Molecular Formula | C9H16ClN5O |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[(5-chloro-2-hydrazinylpyrimidin-4-yl)-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)c1nc(NN)ncc1Cl |
| InChI | InChI=1S/C9H16ClN5O/c1-6(2)15(3-4-16)8-7(10)5-12-9(13-8)14-11/h5-6,16H,3-4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | DBHSSFNTAKPVAW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|