C11H19ClN6 — CID 80914641
5-chloro-2-hydrazinyl-N-methyl-N-(2-pyrrolidin-1-ylethyl)pyrimidin-4-amine (PubChem CID 80914641) has the molecular formula C11H19ClN6 and a molecular weight of 270.77 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-methyl-N-(2-pyrrolidin-1-ylethyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-2-hydrazinyl-N-methyl-N-(2-pyrrolidin-1-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80914641 |
| Molecular Formula | C11H19ClN6 |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-methyl-N-(2-pyrrolidin-1-ylethyl)pyrimidin-4-amine |
| SMILES | CN(CCN1CCCC1)c1nc(NN)ncc1Cl |
| InChI | InChI=1S/C11H19ClN6/c1-17(6-7-18-4-2-3-5-18)10-9(12)8-14-11(15-10)16-13/h8H,2-7,13H2,1H3,(H,14,15,16) |
| InChIKey | NCMUTHJSANWWAA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|