C12H13Cl2N5 — CID 80896298
5-chloro-N-[(4-chlorophenyl)methyl]-2-hydrazinyl-N-methylpyrimidin-4-amine (PubChem CID 80896298) has the molecular formula C12H13Cl2N5 and a molecular weight of 298.18 g/mol. Its IUPAC name is 5-chloro-N-[(4-chlorophenyl)methyl]-2-hydrazinyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[(4-chlorophenyl)methyl]-2-hydrazinyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80896298 |
| Molecular Formula | C12H13Cl2N5 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-chloro-N-[(4-chlorophenyl)methyl]-2-hydrazinyl-N-methylpyrimidin-4-amine |
| SMILES | CN(Cc1ccc(Cl)cc1)c1nc(NN)ncc1Cl |
| InChI | InChI=1S/C12H13Cl2N5/c1-19(7-8-2-4-9(13)5-3-8)11-10(14)6-16-12(17-11)18-15/h2-6H,7,15H2,1H3,(H,16,17,18) |
| InChIKey | SURJIYFRXYAZRP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|