C12H20FN5O — CID 80821237
2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide (PubChem CID 80821237) has the molecular formula C12H20FN5O and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 80821237 |
| Molecular Formula | C12H20FN5O |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[[2-(ethylamino)-5-fluoropyrimidin-4-yl]-methylamino]-N-propan-2-ylacetamide |
| SMILES | CCNc1ncc(F)c(N(C)CC(=O)NC(C)C)n1 |
| InChI | InChI=1S/C12H20FN5O/c1-5-14-12-15-6-9(13)11(17-12)18(4)7-10(19)16-8(2)3/h6,8H,5,7H2,1-4H3,(H,16,19)(H,14,15,17) |
| InChIKey | RMVJUUJNCFIYGH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |