C19H23N5 — CID 147103146
4-N-butyl-6-(1-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 147103146) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 4-N-butyl-6-(1-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-(1-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 147103146 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-N-butyl-6-(1-phenylethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc2ccc(C(C)c3ccccc3)nc12 |
| InChI | InChI=1S/C19H23N5/c1-3-4-12-21-18-17-16(23-19(20)24-18)11-10-15(22-17)13(2)14-8-6-5-7-9-14/h5-11,13H,3-4,12H2,1-2H3,(H3,20,21,23,24) |
| InChIKey | BLAVUOGNOLKBKO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|