C18H20FN5 — CID 69095647
6-(4-fluorophenyl)-4-N-pentylpyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 69095647) has the molecular formula C18H20FN5 and a molecular weight of 325.39 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-N-pentylpyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-(4-fluorophenyl)-4-N-pentylpyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 69095647 |
| Molecular Formula | C18H20FN5 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 6-(4-fluorophenyl)-4-N-pentylpyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C18H20FN5/c1-2-3-4-11-21-17-16-15(23-18(20)24-17)10-9-14(22-16)12-5-7-13(19)8-6-12/h5-10H,2-4,11H2,1H3,(H3,20,21,23,24) |
| InChIKey | AJGZGSVIRMFSEK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|