C23H15FN4 — CID 68913112
6-(4-fluorophenyl)-4-naphthalen-2-ylpyrido[3,2-d]pyrimidin-2-amine (PubChem CID 68913112) has the molecular formula C23H15FN4 and a molecular weight of 366.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-naphthalen-2-ylpyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-(4-fluorophenyl)-4-naphthalen-2-ylpyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68913112 |
| Molecular Formula | C23H15FN4 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 6-(4-fluorophenyl)-4-naphthalen-2-ylpyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccc3ccccc3c2)c2nc(-c3ccc(F)cc3)ccc2n1 |
| InChI | InChI=1S/C23H15FN4/c24-18-9-7-15(8-10-18)19-11-12-20-22(26-19)21(28-23(25)27-20)17-6-5-14-3-1-2-4-16(14)13-17/h1-13H,(H2,25,27,28) |
| InChIKey | IOYAMNQOULVYST-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |