C25H16FN3 — CID 68914278
6-(4-fluorophenyl)-4-(4-phenylphenyl)pyrido[3,2-d]pyrimidine (PubChem CID 68914278) has the molecular formula C25H16FN3 and a molecular weight of 377.42 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-(4-phenylphenyl)pyrido[3,2-d]pyrimidine.
| Compound Name | 6-(4-fluorophenyl)-4-(4-phenylphenyl)pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 68914278 |
| Molecular Formula | C25H16FN3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 6-(4-fluorophenyl)-4-(4-phenylphenyl)pyrido[3,2-d]pyrimidine |
| SMILES | Fc1ccc(-c2ccc3ncnc(-c4ccc(-c5ccccc5)cc4)c3n2)cc1 |
| InChI | InChI=1S/C25H16FN3/c26-21-12-10-19(11-13-21)22-14-15-23-25(29-22)24(28-16-27-23)20-8-6-18(7-9-20)17-4-2-1-3-5-17/h1-16H |
| InChIKey | HKZUPQXVZQUALQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |