About N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine
N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 150209313) has the molecular formula C19H14N4
and a molecular weight of 298.35 g/mol. Its IUPAC name is N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 150209313 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(Nc2ncnc3ccc(-c4ccccc4)nc23)cc1 |
| InChI | InChI=1S/C19H14N4/c1-3-7-14(8-4-1)16-11-12-17-18(23-16)19(21-13-20-17)22-15-9-5-2-6-10-15/h1-13H,(H,20,21,22) |
| InChIKey | FRDJWTUIMNCGHL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine (CID 150209313) is N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine is c1ccc(Nc2ncnc3ccc(-c4ccccc4)nc23)cc1.
What is the InChIKey of N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is FRDJWTUIMNCGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4/c1-3-7-14(8-4-1)16-11-12-17-18(23-16)19(21-13-20-17)22-15-9-5-2-6-10-15/h1-13H,(H,20,21,22).
What are the key properties of N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine?
N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 298.35 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 150209313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).