C19H14N4 — CID 150209313
N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 150209313) has the molecular formula C19H14N4 and a molecular weight of 298.35 g/mol. Its IUPAC name is N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 150209313 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N,6-diphenylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(Nc2ncnc3ccc(-c4ccccc4)nc23)cc1 |
| InChI | InChI=1S/C19H14N4/c1-3-7-14(8-4-1)16-11-12-17-18(23-16)19(21-13-20-17)22-15-9-5-2-6-10-15/h1-13H,(H,20,21,22) |
| InChIKey | FRDJWTUIMNCGHL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |