C17H13N5S — CID 11529827
2-N,7-N-diphenyl-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine (PubChem CID 11529827) has the molecular formula C17H13N5S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-N,7-N-diphenyl-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine.
| Compound Name | 2-N,7-N-diphenyl-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 11529827 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-N,7-N-diphenyl-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
| SMILES | c1ccc(Nc2nc3c(Nc4ccccc4)ncnc3s2)cc1 |
| InChI | InChI=1S/C17H13N5S/c1-3-7-12(8-4-1)20-15-14-16(19-11-18-15)23-17(22-14)21-13-9-5-2-6-10-13/h1-11H,(H,21,22)(H,18,19,20) |
| InChIKey | ZTHKYQVIGVTAJB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |